CAS 69363-14-0 appears in our catalog under these names: Schisanhenol, 95%, Schisanhenol, Schisanhenol/ 99.99%, Gomisin K3, >98.0%(GC), Schisanhenol, 99+%, 99+%. Offered by: Combi-blocks, GLPBio, TargetMol, TCI, Biosynth. Available pack sizes: 25mg, 5mg, 20mg, 1mg, 10mg, 50mg, 100mg, 2mg.
(9S,10R)-4,5,14,15,16-pentamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-3-ol (CAS 69363-14-0) is a chemical compound with the molecular formula C23H30O6 and a molecular weight of 402.5 g/mol. IUPAC name: (9S,10R)-4,5,14,15,16-pentamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-3-ol. InChIKey: FYSHYFPJBONYCQ-QWHCGFSZSA-N.
| Molecular formula | C23H30O6 |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | (9S,10R)-4,5,14,15,16-pentamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-3-ol |
| InChIKey | FYSHYFPJBONYCQ-QWHCGFSZSA-N |
| SMILES | C[C@H]1CC2=CC(=C(C(=C2C3=C(C(=C(C=C3C[C@H]1C)OC)OC)OC)O)OC)OC |
Computed by PubChem (NCBI)