CAS 69369-16-0 appears in our catalog under these names: 2,6-Diaminopurine hemisulfate salt, 95%, 2,6-Diaminopurine Hemisulfate. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 1g, 10g, 5g, 25g.
Bis(7H-purine-2,6-diamine);sulfuric acid (CAS 69369-16-0) is a chemical compound with the molecular formula C10H14N12O4S and a molecular weight of 398.37 g/mol. IUPAC name: bis(7H-purine-2,6-diamine);sulfuric acid. InChIKey: HNHVJLBUCSUIFH-UHFFFAOYSA-N.
| Molecular formula | C10H14N12O4S |
|---|---|
| Molecular weight | 398.37 g/mol |
| IUPAC name | bis(7H-purine-2,6-diamine);sulfuric acid |
| InChIKey | HNHVJLBUCSUIFH-UHFFFAOYSA-N |
| SMILES | C1=NC2=NC(=NC(=C2N1)N)N.C1=NC2=NC(=NC(=C2N1)N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)