Products 69383-05-7
CAS 69383-05-7 is the registry number for 3′-Deoxy CTP. Offered by: MedChemExpress. Available pack sizes: Get quote.
[[(2S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (CAS 69383-05-7) is a chemical compound with the molecular formula C9H16N3O13P3 and a molecular weight of 467.16 g/mol. IUPAC name: [[(2S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate. InChIKey: CHKFLBOLYREYDO-SHYZEUOFSA-N.
| Molecular formula | C9H16N3O13P3 |
|---|---|
| Molecular weight | 467.16 g/mol |
| IUPAC name | [[(2S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| InChIKey | CHKFLBOLYREYDO-SHYZEUOFSA-N |
| SMILES | C1[C@H](O[C@H]([C@@H]1O)N2C=CC(=NC2=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
Computed by PubChem (NCBI)