CAS 69389-21-5 appears in our catalog under these names: 1-(1H-1,2,4-Triazol-3-yl)piperazine dihydrochloride, 95%, 1-(1H-1,2,4-Triazol-3-yl)piperazine dihydrochloride, 97%, 1-(1H-1,2,4-Triazol-3-yl)piperazine dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 0,5g.
1-(1H-1,2,4-triazol-5-yl)piperazine;dihydrochloride (CAS 69389-21-5) is a chemical compound with the molecular formula C6H13Cl2N5 and a molecular weight of 226.10 g/mol. IUPAC name: 1-(1H-1,2,4-triazol-5-yl)piperazine;dihydrochloride. InChIKey: IEPQQKAKFFTFMC-UHFFFAOYSA-N.
| Molecular formula | C6H13Cl2N5 |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 1-(1H-1,2,4-triazol-5-yl)piperazine;dihydrochloride |
| InChIKey | IEPQQKAKFFTFMC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=NN2.Cl.Cl |
Computed by PubChem (NCBI)