Products 6941-16-8
CAS 6941-16-8 appears in our catalog under these names: 2-Amino-2,3-dihydroinden-1-one hydrochloride, 98%, 2-Amino-2,3-dihydro-1H-inden-1-one hydrochloride, 1H-Inden-1-one, 2-amino-2,3-dihydro-, hydrochloride (1:1), 95%, 95%, 2-Amino-2,3-dihydro-1H-inden-1-one hydrochloride, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25mg, 10mg, 50mg, 100mg.
2-amino-2,3-dihydroinden-1-one;hydrochloride (CAS 6941-16-8) is a chemical compound with the molecular formula C9H10ClNO and a molecular weight of 183.63 g/mol. IUPAC name: 2-amino-2,3-dihydroinden-1-one;hydrochloride. InChIKey: AORFTSYQWUGEFL-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | 2-amino-2,3-dihydroinden-1-one;hydrochloride |
| InChIKey | AORFTSYQWUGEFL-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)C2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)