CAS 694439-20-8 appears in our catalog under these names: 4-Fluoro-2-nitrophenyl beta-d-galactopyranoside, 95%, 4-Fluoro-2-nitrophenyl b-D-galactopyranoside. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 1000mg, 500mg, 2000mg, 5000mg.
(2S,3R,4S,5R,6R)-2-(4-fluoro-2-nitrophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 694439-20-8) is a chemical compound with the molecular formula C12H14FNO8 and a molecular weight of 319.24 g/mol. IUPAC name: (2S,3R,4S,5R,6R)-2-(4-fluoro-2-nitrophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: ZAZQJSCONGIOHE-YBXAARCKSA-N.
| Molecular formula | C12H14FNO8 |
|---|---|
| Molecular weight | 319.24 g/mol |
| IUPAC name | (2S,3R,4S,5R,6R)-2-(4-fluoro-2-nitrophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | ZAZQJSCONGIOHE-YBXAARCKSA-N |
| SMILES | C1=CC(=C(C=C1F)[N+](=O)[O-])O[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)