CAS 69444-47-9 appears in our catalog under these names: Triethylmethylammonium tetrafluoroborate, 98%, N,N–Diethyl–N–methylethanaminium tetrafluoroborate, Triethylmethylammonium Tetrafluoroborate, >98.0%(N), N,N-Diethyl-N-methylethanaminium tetrafluoroborate, 97%, 97%, N,N-Diethyl-N-methylethanaminium (tetrafluoroborate), 97.0%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, MedChemExpress. Available pack sizes: 25g, 100g, 1g, 5g, 500g, 50 g, 25 g, 100 g.
Triethyl(methyl)azanium tetrafluoroborate (CAS 69444-47-9) is a chemical compound with the molecular formula C7H18BF4N and a molecular weight of 203.03 g/mol. IUPAC name: triethyl(methyl)azanium tetrafluoroborate. InChIKey: OHZMHURLSZDGTO-UHFFFAOYSA-N.
| Molecular formula | C7H18BF4N |
|---|---|
| Molecular weight | 203.03 g/mol |
| IUPAC name | triethyl(methyl)azanium tetrafluoroborate |
| InChIKey | OHZMHURLSZDGTO-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CC[N+](C)(CC)CC |
Computed by PubChem (NCBI)