CAS 69444-51-5 appears in our catalog under these names: N,N-Dimethylpyrrolidinium tetrafluoroborate, 95%, 95%, 1,1-Dimethylpyrrolidin-1-ium tetrafluoroborate, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
1,1-dimethylpyrrolidin-1-ium tetrafluoroborate (CAS 69444-51-5) is a chemical compound with the molecular formula C6H14BF4N and a molecular weight of 186.99 g/mol. IUPAC name: 1,1-dimethylpyrrolidin-1-ium tetrafluoroborate. InChIKey: QVXREJQVKRNKMK-UHFFFAOYSA-N.
| Molecular formula | C6H14BF4N |
|---|---|
| Molecular weight | 186.99 g/mol |
| IUPAC name | 1,1-dimethylpyrrolidin-1-ium tetrafluoroborate |
| InChIKey | QVXREJQVKRNKMK-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C[N+]1(CCCC1)C |
Computed by PubChem (NCBI)