CAS 694501-34-3 appears in our catalog under these names: 1-Ethyl-4-(2-fluoro-4-nitrophenyl)piperazine, 98%, 1-Ethyl-4-(2-fluoro-4-nitrophenyl)piperazine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 25g, 100g, 5g, 1g, 2,5g.
1-ethyl-4-(2-fluoro-4-nitrophenyl)piperazine (CAS 694501-34-3) is a chemical compound with the molecular formula C12H16FN3O2 and a molecular weight of 253.27 g/mol. IUPAC name: 1-ethyl-4-(2-fluoro-4-nitrophenyl)piperazine. InChIKey: XMJXGMZBNFICRS-UHFFFAOYSA-N.
| Molecular formula | C12H16FN3O2 |
|---|---|
| Molecular weight | 253.27 g/mol |
| IUPAC name | 1-ethyl-4-(2-fluoro-4-nitrophenyl)piperazine |
| InChIKey | XMJXGMZBNFICRS-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)C2=C(C=C(C=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)