Products 6948-37-4
CAS 6948-37-4 is the registry number for 1-(5-Hydroxy-4-methoxy-2-methylphenyl)ethanone, 97%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
1-(5-hydroxy-4-methoxy-2-methylphenyl)ethanone (CAS 6948-37-4) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 1-(5-hydroxy-4-methoxy-2-methylphenyl)ethanone. InChIKey: MFWHQNNQKUUWEX-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 1-(5-hydroxy-4-methoxy-2-methylphenyl)ethanone |
| InChIKey | MFWHQNNQKUUWEX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)C)O)OC |
Computed by PubChem (NCBI)