CAS 69502-27-8 appears in our catalog under these names: Heptaethylene glycol di(p-toluenesulfonate), 95%, Bis-Tos-PEG7/ 95.02% (existing batch purity), Bis–Tos–PEG7, Bis-Tos-PEG7, 98%, 98%, Bis-Tos-PEG7, 99.55%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 5g, 1g, 10mg, 25mg, 50mg, 100mg, 250 mg.
2-[2-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 69502-27-8) is a chemical compound with the molecular formula C28H42O12S2 and a molecular weight of 634.8 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: UQNONDOAUSICGF-UHFFFAOYSA-N.
| Molecular formula | C28H42O12S2 |
|---|---|
| Molecular weight | 634.8 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | UQNONDOAUSICGF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCCOCCOCCOS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)