CAS 695168-08-2 is the registry number for N-2-Benzothiazolyl biphenyl-2-carboxamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.
N-(1,3-benzothiazol-2-yl)-2-phenylbenzamide (CAS 695168-08-2) is a chemical compound with the molecular formula C20H14N2OS and a molecular weight of 330.4 g/mol. IUPAC name: N-(1,3-benzothiazol-2-yl)-2-phenylbenzamide. InChIKey: YXQDRDTYPDSFQW-UHFFFAOYSA-N.
| Molecular formula | C20H14N2OS |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | N-(1,3-benzothiazol-2-yl)-2-phenylbenzamide |
| InChIKey | YXQDRDTYPDSFQW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C(=O)NC3=NC4=CC=CC=C4S3 |
Computed by PubChem (NCBI)