CAS 695207-56-8 appears in our catalog under these names: BC-LI-0186, 98%, BC–LI–0186, BC-LI-0186/ 99.17% (existing batch purity), BC-LI-0186, 4-(4-Isopropyl-2,3-dimethyl-5-oxo-2,5-dihydro-1H-pyrazol-1-yl)-N-(2-phenoxyethyl)benzenesulfonamide, 99.71% ,, 99.71% ,. Offered by: AmBeed, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 100mg, 25mg, 5mg, 1mg, 2mg, 10mg.
4-(2,3-dimethyl-5-oxo-4-propan-2-ylpyrazol-1-yl)-N-(2-phenoxyethyl)benzenesulfonamide (CAS 695207-56-8) is a chemical compound with the molecular formula C22H27N3O4S and a molecular weight of 429.5 g/mol. IUPAC name: 4-(2,3-dimethyl-5-oxo-4-propan-2-ylpyrazol-1-yl)-N-(2-phenoxyethyl)benzenesulfonamide. InChIKey: SQYWMHPZMHDCHP-UHFFFAOYSA-N.
| Molecular formula | C22H27N3O4S |
|---|---|
| Molecular weight | 429.5 g/mol |
| IUPAC name | 4-(2,3-dimethyl-5-oxo-4-propan-2-ylpyrazol-1-yl)-N-(2-phenoxyethyl)benzenesulfonamide |
| InChIKey | SQYWMHPZMHDCHP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=C(C=C2)S(=O)(=O)NCCOC3=CC=CC=C3)C(C)C |
Computed by PubChem (NCBI)