Products 69526-89-2
CAS 69526-89-2 appears in our catalog under these names: 3-Formyl-4-methylbenzoic acid, 95%, 3-Formyl-4-methylbenzoic Acid, 3–Formyl–4–methylbenzoic Acid, 3-Formyl-4-methylbenzoic Acid 98%, 3-Formyl-4-methylbenzoic acid, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 100mg, 10g, 1g, 5g, 500mg, 0,5g.
3-formyl-4-methylbenzoic acid (CAS 69526-89-2) is a chemical compound with the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. IUPAC name: 3-formyl-4-methylbenzoic acid. InChIKey: REPNRLBITGLALU-UHFFFAOYSA-N.
| Molecular formula | C9H8O3 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 3-formyl-4-methylbenzoic acid |
| InChIKey | REPNRLBITGLALU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)C=O |
Computed by PubChem (NCBI)