CAS 69538-61-0 is the registry number for N-Acetyl Taurine Sodium Salt. Offered by: TRC. Available pack sizes: 50mg.
Sodium 2-acetamidoethanesulfonate (CAS 69538-61-0) is a chemical compound with the molecular formula C4H8NNaO4S and a molecular weight of 189.17 g/mol. IUPAC name: sodium 2-acetamidoethanesulfonate. InChIKey: BLMGCWKTPLCEGA-UHFFFAOYSA-M.
| Molecular formula | C4H8NNaO4S |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | sodium 2-acetamidoethanesulfonate |
| InChIKey | BLMGCWKTPLCEGA-UHFFFAOYSA-M |
| SMILES | CC(=O)NCCS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)