CAS 69550-28-3 appears in our catalog under these names: Chlorotri-t-butylphosphinegold(I), 98%, Chloro(tri–tert–butylphosphine)gold(I), Chlorotri-t-butylphosphinegold(I) 95%, CHLORO(TRI-TERT-BUTYLPHOSPHINE)GOLD(I). Offered by: AmBeed, GLPBio, Sigma-Aldrich. Available pack sizes: 50mg, 250mg, 1g, 100mg.
Chlorogold;tritert-butylphosphane (CAS 69550-28-3) is a chemical compound with the molecular formula C12H27AuClP and a molecular weight of 434.73 g/mol. IUPAC name: chlorogold;tritert-butylphosphane. InChIKey: JLXSZGSXDDQSJF-UHFFFAOYSA-M.
| Molecular formula | C12H27AuClP |
|---|---|
| Molecular weight | 434.73 g/mol |
| IUPAC name | chlorogold;tritert-butylphosphane |
| InChIKey | JLXSZGSXDDQSJF-UHFFFAOYSA-M |
| SMILES | CC(C)(C)P(C(C)(C)C)C(C)(C)C.Cl[Au] |
Computed by PubChem (NCBI)