CAS 69559-56-4 is the registry number for N-(2-Acetylphenyl)-2,2,2-trichloroacetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-(2-acetylphenyl)-2,2,2-trichloroacetamide (CAS 69559-56-4) is a chemical compound with the molecular formula C10H8Cl3NO2 and a molecular weight of 280.5 g/mol. IUPAC name: N-(2-acetylphenyl)-2,2,2-trichloroacetamide. InChIKey: UDRBJVPGWJWEKC-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl3NO2 |
|---|---|
| Molecular weight | 280.5 g/mol |
| IUPAC name | N-(2-acetylphenyl)-2,2,2-trichloroacetamide |
| InChIKey | UDRBJVPGWJWEKC-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC=C1NC(=O)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)