CAS 6956-76-9 is the registry number for 2,2-Dimethyl-2,3-dihydrobenzofuran-5-ol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dimethyl-3H-1-benzofuran-5-ol (CAS 6956-76-9) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. IUPAC name: 2,2-dimethyl-3H-1-benzofuran-5-ol. InChIKey: SQYKKVNYUCVHOT-UHFFFAOYSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 164.20 g/mol |
| IUPAC name | 2,2-dimethyl-3H-1-benzofuran-5-ol |
| InChIKey | SQYKKVNYUCVHOT-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C=CC(=C2)O)C |
Computed by PubChem (NCBI)