CAS 69563-07-1 is the registry number for 2,2,2-Trifluoro-N-(3-(trifluoromethyl)phenyl)acetimidoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-N-[3-(trifluoromethyl)phenyl]ethanimidoyl chloride (CAS 69563-07-1) is a chemical compound with the molecular formula C9H4ClF6N and a molecular weight of 275.58 g/mol. IUPAC name: 2,2,2-trifluoro-N-[3-(trifluoromethyl)phenyl]ethanimidoyl chloride. InChIKey: RKUXRHQQKBFMDP-UHFFFAOYSA-N.
| Molecular formula | C9H4ClF6N |
|---|---|
| Molecular weight | 275.58 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-[3-(trifluoromethyl)phenyl]ethanimidoyl chloride |
| InChIKey | RKUXRHQQKBFMDP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N=C(C(F)(F)F)Cl)C(F)(F)F |
Computed by PubChem (NCBI)