CAS 69567-11-9 appears in our catalog under these names: Deoxynojirimycin tetrabenzyl ether, 95%, 3,4,5-Tris(benzyloxy)-2-((benzyloxy)methyl)piperidine, 95%, Deoxynojirimycin Tetrabenzyl Ether, Deoxynojirimycin Tetrabenzyl Ether. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 250mg, 1g, 5mg, 10mg, 25mg, 50mg, 1mg, 25 mg.
(2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine (CAS 69567-11-9) is a chemical compound with the molecular formula C34H37NO4 and a molecular weight of 523.7 g/mol. IUPAC name: (2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine. InChIKey: HHIIDKLQTCPFQA-KMKAFXEASA-N.
| Molecular formula | C34H37NO4 |
|---|---|
| Molecular weight | 523.7 g/mol |
| IUPAC name | (2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine |
| InChIKey | HHIIDKLQTCPFQA-KMKAFXEASA-N |
| SMILES | C1[C@@H]([C@H]([C@@H]([C@H](N1)COCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5 |
Computed by PubChem (NCBI)