CAS 69606-52-6 is the registry number for Pentachlorophenyl Cyanoacetate. Offered by: TRC. Available pack sizes: 100mg.
(2,3,4,5,6-pentachlorophenyl) 2-cyanoacetate (CAS 69606-52-6) is a chemical compound with the molecular formula C9H2Cl5NO2 and a molecular weight of 333.4 g/mol. IUPAC name: (2,3,4,5,6-pentachlorophenyl) 2-cyanoacetate. InChIKey: LVJLBAOLANVTDO-UHFFFAOYSA-N.
| Molecular formula | C9H2Cl5NO2 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | (2,3,4,5,6-pentachlorophenyl) 2-cyanoacetate |
| InChIKey | LVJLBAOLANVTDO-UHFFFAOYSA-N |
| SMILES | C(C#N)C(=O)OC1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)