CAS 696643-14-8 is the registry number for HTS05585. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(7-ethylimidazo[1,2-a]pyridin-2-yl)-3-phenyl-1,2-oxazole (CAS 696643-14-8) is a chemical compound with the molecular formula C18H15N3O and a molecular weight of 289.3 g/mol. IUPAC name: 5-(7-ethylimidazo[1,2-a]pyridin-2-yl)-3-phenyl-1,2-oxazole. InChIKey: DBKOZDXYQZKMBC-UHFFFAOYSA-N.
| Molecular formula | C18H15N3O |
|---|---|
| Molecular weight | 289.3 g/mol |
| IUPAC name | 5-(7-ethylimidazo[1,2-a]pyridin-2-yl)-3-phenyl-1,2-oxazole |
| InChIKey | DBKOZDXYQZKMBC-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=NC(=CN2C=C1)C3=CC(=NO3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)