Products 696647-51-5

CAS 696647-51-5 is the registry number for 1-(3-Chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 696647-51-5) is a chemical compound with the molecular formula C11H9ClFNO3 and a molecular weight of 257.64 g/mol. IUPAC name: 1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: BMPMCEJUODXJTL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9ClFNO3
Molecular weight257.64 g/mol
IUPAC name1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyBMPMCEJUODXJTL-UHFFFAOYSA-N
SMILESC1C(CN(C1=O)C2=CC(=C(C=C2)F)Cl)C(=O)O

Computed by PubChem (NCBI)