Products 69682-14-0
CAS 69682-14-0 is the registry number for rac-(2R,4R,6S)-2,4,6-Trimethylpiperidine hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
(2R,6S)-2,4,6-trimethylpiperidine;hydrochloride (CAS 69682-14-0) is a chemical compound with the molecular formula C8H18ClN and a molecular weight of 163.69 g/mol. IUPAC name: (2R,6S)-2,4,6-trimethylpiperidine;hydrochloride. InChIKey: CEDJUMOWFACOGK-OPZYXJLOSA-N.
| Molecular formula | C8H18ClN |
|---|---|
| Molecular weight | 163.69 g/mol |
| IUPAC name | (2R,6S)-2,4,6-trimethylpiperidine;hydrochloride |
| InChIKey | CEDJUMOWFACOGK-OPZYXJLOSA-N |
| SMILES | C[C@@H]1CC(C[C@@H](N1)C)C.Cl |
Computed by PubChem (NCBI)