CAS 697-17-6 is the registry number for 1,1,2-Trichloro-2,3,3-trifluorocyclobutane, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
1,1,2-trichloro-2,3,3-trifluorocyclobutane (CAS 697-17-6) is a chemical compound with the molecular formula C4H2Cl3F3 and a molecular weight of 213.41 g/mol. IUPAC name: 1,1,2-trichloro-2,3,3-trifluorocyclobutane. InChIKey: YMUQFZZNJWUHMC-UHFFFAOYSA-N.
| Molecular formula | C4H2Cl3F3 |
|---|---|
| Molecular weight | 213.41 g/mol |
| IUPAC name | 1,1,2-trichloro-2,3,3-trifluorocyclobutane |
| InChIKey | YMUQFZZNJWUHMC-UHFFFAOYSA-N |
| SMILES | C1C(C(C1(Cl)Cl)(F)Cl)(F)F |
Computed by PubChem (NCBI)