CAS 69701-39-9 is the registry number for Copper, bis(2,2,7-trimethyl-3,5-octanedionato-O,O')-, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper bis(2,2,7-trimethyloctane-3,5-dione) (CAS 69701-39-9) is a chemical compound with the molecular formula C22H38CuO4 and a molecular weight of 430.1 g/mol. IUPAC name: copper bis(2,2,7-trimethyloctane-3,5-dione). InChIKey: CCBUYMBDISAXAM-UHFFFAOYSA-N.
| Molecular formula | C22H38CuO4 |
|---|---|
| Molecular weight | 430.1 g/mol |
| IUPAC name | copper bis(2,2,7-trimethyloctane-3,5-dione) |
| InChIKey | CCBUYMBDISAXAM-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)[CH-]C(=O)C(C)(C)C.CC(C)CC(=O)[CH-]C(=O)C(C)(C)C.[Cu+2] |
Computed by PubChem (NCBI)