CAS 69705-14-2 is the registry number for Biotin tosylate, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 100mg.
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentyl 4-methylbenzenesulfonate (CAS 69705-14-2) is a chemical compound with the molecular formula C17H24N2O4S2 and a molecular weight of 384.5 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentyl 4-methylbenzenesulfonate. InChIKey: UDUANLIDXRGFFO-JYJNAYRXSA-N.
| Molecular formula | C17H24N2O4S2 |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentyl 4-methylbenzenesulfonate |
| InChIKey | UDUANLIDXRGFFO-JYJNAYRXSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCCC[C@H]2[C@@H]3[C@H](CS2)NC(=O)N3 |
Computed by PubChem (NCBI)