CAS 69726-86-9 is the registry number for N,N-Dimethylbenzenesulfonoimidamide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
N-methyl-N-(phenylsulfonimidoyl)methanamine (CAS 69726-86-9) is a chemical compound with the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. IUPAC name: N-methyl-N-(phenylsulfonimidoyl)methanamine. InChIKey: GBYIDZXKVPVBPS-UHFFFAOYSA-N.
| Molecular formula | C8H12N2OS |
|---|---|
| Molecular weight | 184.26 g/mol |
| IUPAC name | N-methyl-N-(phenylsulfonimidoyl)methanamine |
| InChIKey | GBYIDZXKVPVBPS-UHFFFAOYSA-N |
| SMILES | CN(C)S(=N)(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)