CAS 697301-70-5 is the registry number for Acetophenone Related Compound 1. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(1-phenylethenyl)carbamate (CAS 697301-70-5) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: tert-butyl N-(1-phenylethenyl)carbamate. InChIKey: FNECWCBXYVZUGA-UHFFFAOYSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | tert-butyl N-(1-phenylethenyl)carbamate |
| InChIKey | FNECWCBXYVZUGA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(=C)C1=CC=CC=C1 |
Computed by PubChem (NCBI)