CAS 69755-85-7 is the registry number for Bis[1-(4-methylphenyl)-1,3-butanedionato-O,O']copper, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper bis(1-(4-methylphenyl)butane-1,3-dione) (CAS 69755-85-7) is a chemical compound with the molecular formula C22H22CuO4 and a molecular weight of 414.0 g/mol. IUPAC name: copper bis(1-(4-methylphenyl)butane-1,3-dione). InChIKey: QZRMAEJYZBYNFG-UHFFFAOYSA-N.
| Molecular formula | C22H22CuO4 |
|---|---|
| Molecular weight | 414.0 g/mol |
| IUPAC name | copper bis(1-(4-methylphenyl)butane-1,3-dione) |
| InChIKey | QZRMAEJYZBYNFG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)[CH-]C(=O)C.CC1=CC=C(C=C1)C(=O)[CH-]C(=O)C.[Cu+2] |
Computed by PubChem (NCBI)