Products 69781-24-4

CAS 69781-24-4 is the registry number for 2-(Diethylamino)ethyl 3-Amino-4-ethoxybenzoate Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 50mg, 100mg.

Structural formula: {0} (CAS {1})

2-(3-amino-4-ethoxybenzoyl)oxyethyl-diethylazanium chloride (CAS 69781-24-4) is a chemical compound with the molecular formula C15H25ClN2O3 and a molecular weight of 316.82 g/mol. IUPAC name: 2-(3-amino-4-ethoxybenzoyl)oxyethyl-diethylazanium chloride. InChIKey: JTOKECMTNYNKBC-UHFFFAOYSA-N.

Identity
Molecular formulaC15H25ClN2O3
Molecular weight316.82 g/mol
IUPAC name2-(3-amino-4-ethoxybenzoyl)oxyethyl-diethylazanium chloride
InChIKeyJTOKECMTNYNKBC-UHFFFAOYSA-N
SMILESCC[NH+](CC)CCOC(=O)C1=CC(=C(C=C1)OCC)N.[Cl-]

Computed by PubChem (NCBI)