CAS 69812-29-9 appears in our catalog under these names: 2–Acetamido–4–methyl–5–thiazolesulfonyl chloride, 2-Acetamido-4-methylthiazole-5-sulfonyl Chloride, >98.0%(HPLC)(T), 2-Acetamido-4-methyl-5-thiazolesulfonyl chloride, 97%, 2-Acetamido-4-methylthiazole-5-sulfonyl chloride, 97%. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
2-acetamido-4-methyl-1,3-thiazole-5-sulfonyl chloride (CAS 69812-29-9) is a chemical compound with the molecular formula C6H7ClN2O3S2 and a molecular weight of 254.7 g/mol. IUPAC name: 2-acetamido-4-methyl-1,3-thiazole-5-sulfonyl chloride. InChIKey: NXGKPRKPUCSEIL-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O3S2 |
|---|---|
| Molecular weight | 254.7 g/mol |
| IUPAC name | 2-acetamido-4-methyl-1,3-thiazole-5-sulfonyl chloride |
| InChIKey | NXGKPRKPUCSEIL-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC(=O)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)