CAS 69815-49-2 appears in our catalog under these names: L–4–(2–Amino–1–hydroxyethyl)–1,2–benzenediol bitartrate, Noradrenaline bitartrate/ 99.97% (existing batch purity), 4-[(1R)-2-amino-1-hydroxyethyl]-1,2-benzenediol bitartrate monohydrate, 98%+, 98%+. Offered by: GLPBio, TargetMol, Chemat. Available pack sizes: 1g, 25g, 5g, 50mg, 100mg, 200mg.
4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol;(2R,3R)-2,3-dihydroxybutanedioic acid;hydrate (CAS 69815-49-2) is a chemical compound with the molecular formula C12H19NO10 and a molecular weight of 337.28 g/mol. IUPAC name: 4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol;(2R,3R)-2,3-dihydroxybutanedioic acid;hydrate. InChIKey: LNBCGLZYLJMGKP-LUDZCAPTSA-N.
| Molecular formula | C12H19NO10 |
|---|---|
| Molecular weight | 337.28 g/mol |
| IUPAC name | 4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol;(2R,3R)-2,3-dihydroxybutanedioic acid;hydrate |
| InChIKey | LNBCGLZYLJMGKP-LUDZCAPTSA-N |
| SMILES | C1=CC(=C(C=C1[C@H](CN)O)O)O.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O.O |
Computed by PubChem (NCBI)