CAS 698367-34-9 appears in our catalog under these names: 7-Fluorobenzo[b]thiophene-2-carboxaldehyde, 95%, 7-Fluorobenzo(b)thiophene-2-carboxaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g.
7-fluoro-1-benzothiophene-2-carbaldehyde (CAS 698367-34-9) is a chemical compound with the molecular formula C9H5FOS and a molecular weight of 180.20 g/mol. IUPAC name: 7-fluoro-1-benzothiophene-2-carbaldehyde. InChIKey: DRXRATOOAJQGST-UHFFFAOYSA-N.
| Molecular formula | C9H5FOS |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 7-fluoro-1-benzothiophene-2-carbaldehyde |
| InChIKey | DRXRATOOAJQGST-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)SC(=C2)C=O |
Computed by PubChem (NCBI)