Products 69839-80-1
CAS 69839-80-1 is the registry number for L-Chlorozotocin. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(2-chloroethyl)-1-nitroso-3-[(2S,3S,4R,5S)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]urea (CAS 69839-80-1) is a chemical compound with the molecular formula C9H16ClN3O7 and a molecular weight of 313.69 g/mol. IUPAC name: 1-(2-chloroethyl)-1-nitroso-3-[(2S,3S,4R,5S)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]urea. InChIKey: MKQWTWSXVILIKJ-KVPKETBZSA-N.
| Molecular formula | C9H16ClN3O7 |
|---|---|
| Molecular weight | 313.69 g/mol |
| IUPAC name | 1-(2-chloroethyl)-1-nitroso-3-[(2S,3S,4R,5S)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]urea |
| InChIKey | MKQWTWSXVILIKJ-KVPKETBZSA-N |
| SMILES | C(CCl)N(C(=O)N[C@H](C=O)[C@@H]([C@H]([C@H](CO)O)O)O)N=O |
Computed by PubChem (NCBI)