CAS 69868-09-3 is the registry number for Hydroxy[2-(hydroxy-κO)-4-hydroxybenzoato-κO]copper, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper;2-carboxy-5-hydroxyphenolate;hydroxide (CAS 69868-09-3) is a chemical compound with the molecular formula C7H6CuO5 and a molecular weight of 233.67 g/mol. IUPAC name: copper;2-carboxy-5-hydroxyphenolate;hydroxide. InChIKey: MZCSXSKMYAZJHK-UHFFFAOYSA-L.
| Molecular formula | C7H6CuO5 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | copper;2-carboxy-5-hydroxyphenolate;hydroxide |
| InChIKey | MZCSXSKMYAZJHK-UHFFFAOYSA-L |
| SMILES | C1=CC(=C(C=C1O)[O-])C(=O)O.[OH-].[Cu+2] |
Computed by PubChem (NCBI)