CAS 69887-15-6 appears in our catalog under these names: Adamantane–1,3–diyldimethanamine dihydrochloride, Adamantane-1,3-diyldimethanamine dihydrochloride 97%, Adamantane-1,3-diyldimethanamine dihydrochloride, 97%, 97%, ADAMANTANE-1,3-DIYLDIMETHANAMINE DIHYDROCHLORIDE, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g.
[3-(aminomethyl)-1-adamantyl]methanamine;dihydrochloride (CAS 69887-15-6) is a chemical compound with the molecular formula C12H24Cl2N2 and a molecular weight of 267.24 g/mol. IUPAC name: [3-(aminomethyl)-1-adamantyl]methanamine;dihydrochloride. InChIKey: WURFXMPEVBIVTB-UHFFFAOYSA-N.
| Molecular formula | C12H24Cl2N2 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | [3-(aminomethyl)-1-adamantyl]methanamine;dihydrochloride |
| InChIKey | WURFXMPEVBIVTB-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)CN)CN.Cl.Cl |
Computed by PubChem (NCBI)