Products 698990-99-7
CAS 698990-99-7 is the registry number for 5-Cyclopropyl-2-methyl-furan-3-carboxylic acid. Offered by: Fluorochem. Available pack sizes: 100mg.
5-cyclopropyl-2-methylfuran-3-carboxylic acid (CAS 698990-99-7) is a chemical compound with the molecular formula C9H10O3 and a molecular weight of 166.17 g/mol. IUPAC name: 5-cyclopropyl-2-methylfuran-3-carboxylic acid. InChIKey: VAMPCJBRSOYETO-UHFFFAOYSA-N.
| Molecular formula | C9H10O3 |
|---|---|
| Molecular weight | 166.17 g/mol |
| IUPAC name | 5-cyclopropyl-2-methylfuran-3-carboxylic acid |
| InChIKey | VAMPCJBRSOYETO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(O1)C2CC2)C(=O)O |
Computed by PubChem (NCBI)