CAS 699-18-3 appears in our catalog under these names: 1–(2–Furyl)–2–nitroethylene, 1-(2-Furyl)-2-nitroethylene 98%, 2-(2-NITROVINYL)-FURAN, 2-[(E)-2-nitroethenyl]furan, 98%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
2-[(E)-2-nitroethenyl]furan (CAS 699-18-3) is a chemical compound with the molecular formula C6H5NO3 and a molecular weight of 139.11 g/mol. IUPAC name: 2-[(E)-2-nitroethenyl]furan. InChIKey: WVUICGOYGDHVBH-ONEGZZNKSA-N.
| Molecular formula | C6H5NO3 |
|---|---|
| Molecular weight | 139.11 g/mol |
| IUPAC name | 2-[(E)-2-nitroethenyl]furan |
| InChIKey | WVUICGOYGDHVBH-ONEGZZNKSA-N |
| SMILES | C1=COC(=C1)/C=C/[N+](=O)[O-] |
Computed by PubChem (NCBI)