CAS 699-30-9 appears in our catalog under these names: Tetrafluorosuccinic anhydride, 98%, Tetrafluorosuccinic Anhydride, Tetrafluorosuccinic Anhydride, >98.0%(GC)(T), TETRAFLUOROSUCCINIC ANHYDRIDE, >=98.0 &, Tetrafluorosuccinicanhydride, ≥98%, ≥98%. Offered by: AmBeed, GLPBio, TCI, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 1g, 200mg, 5g, 500MG.
3,3,4,4-tetrafluorooxolane-2,5-dione (CAS 699-30-9) is a chemical compound with the molecular formula C4F4O3 and a molecular weight of 172.03 g/mol. IUPAC name: 3,3,4,4-tetrafluorooxolane-2,5-dione. InChIKey: ZLVLNNCBGQYRAB-UHFFFAOYSA-N.
| Molecular formula | C4F4O3 |
|---|---|
| Molecular weight | 172.03 g/mol |
| IUPAC name | 3,3,4,4-tetrafluorooxolane-2,5-dione |
| InChIKey | ZLVLNNCBGQYRAB-UHFFFAOYSA-N |
| SMILES | C1(=O)C(C(C(=O)O1)(F)F)(F)F |
Computed by PubChem (NCBI)