CAS 699012-36-7 is the registry number for (-)-Adenosine 3'-monophosphate hydrate. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg.
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate;hydrate (CAS 699012-36-7) is a chemical compound with the molecular formula C10H16N5O8P and a molecular weight of 365.24 g/mol. IUPAC name: [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate;hydrate. InChIKey: HAWIDQLWSQBRQS-MCDZGGTQSA-N.
| Molecular formula | C10H16N5O8P |
|---|---|
| Molecular weight | 365.24 g/mol |
| IUPAC name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate;hydrate |
| InChIKey | HAWIDQLWSQBRQS-MCDZGGTQSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)OP(=O)(O)O)O)N.O |
Computed by PubChem (NCBI)