CAS 69951-02-6 appears in our catalog under these names: 2–Chloro–6–Methyl–4–Nitroaniline, 2-Chloro-6-methyl-4-nitroaniline 97%, 2-Chloro-6-methyl-4-nitroaniline, 95%, 2-Chloro-6-methyl-4-nitroaniline, 97%, 97%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 250mg, 1g, 25g, 100g, 10g.
2-chloro-6-methyl-4-nitroaniline (CAS 69951-02-6) is a chemical compound with the molecular formula C7H7ClN2O2 and a molecular weight of 186.59 g/mol. IUPAC name: 2-chloro-6-methyl-4-nitroaniline. InChIKey: HVPVUAIKGOKEEE-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 2-chloro-6-methyl-4-nitroaniline |
| InChIKey | HVPVUAIKGOKEEE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)