CAS 69973-32-6 appears in our catalog under these names: Methyl beta-Xylobioside, Methyl b1-4-D-xylobioside. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 10mg.
(2S,3R,4S,5R)-2-[(3R,4R,5R,6R)-4,5-dihydroxy-6-methoxyoxan-3-yl]oxyoxane-3,4,5-triol (CAS 69973-32-6) is a chemical compound with the molecular formula C11H20O9 and a molecular weight of 296.27 g/mol. IUPAC name: (2S,3R,4S,5R)-2-[(3R,4R,5R,6R)-4,5-dihydroxy-6-methoxyoxan-3-yl]oxyoxane-3,4,5-triol. InChIKey: RBTWYUVVELVCEW-JWJFVCDFSA-N.
| Molecular formula | C11H20O9 |
|---|---|
| Molecular weight | 296.27 g/mol |
| IUPAC name | (2S,3R,4S,5R)-2-[(3R,4R,5R,6R)-4,5-dihydroxy-6-methoxyoxan-3-yl]oxyoxane-3,4,5-triol |
| InChIKey | RBTWYUVVELVCEW-JWJFVCDFSA-N |
| SMILES | CO[C@H]1[C@@H]([C@H]([C@@H](CO1)O[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)O)O)O |
Computed by PubChem (NCBI)