Products 69974-55-6
CAS 69974-55-6 appears in our catalog under these names: Octanoic Acid-D15, >95% (GC), Octanoic-d15 Acid, 98 atom % D, min 98% Chemical Purity, Octanoic Acid–d15, OCTANOIC-D15 ACID, 98 ATOM % D, 99% (CP&, Octanoic acid-d15, 99.88%. Offered by: TRC, CDN, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 0,5g, 25mg, 50mg, 25 mg, 10 mg.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecadeuteriooctanoic acid (CAS 69974-55-6) is a chemical compound with the molecular formula C8H16O2 and a molecular weight of 159.30 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecadeuteriooctanoic acid. InChIKey: WWZKQHOCKIZLMA-PMELWRBQSA-N.
| Molecular formula | C8H16O2 |
|---|---|
| Molecular weight | 159.30 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecadeuteriooctanoic acid |
| InChIKey | WWZKQHOCKIZLMA-PMELWRBQSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)