CAS 69992-10-5 is the registry number for 2’-Deoxy-3’,5’-di-O-acetylguanosine. Offered by: TRC. Available pack sizes: 100mg.
[(2R,3S,5R)-3-acetyloxy-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate (CAS 69992-10-5) is a chemical compound with the molecular formula C14H17N5O6 and a molecular weight of 351.31 g/mol. IUPAC name: [(2R,3S,5R)-3-acetyloxy-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate. InChIKey: QZGYRDUIRRZJHS-IVZWLZJFSA-N.
| Molecular formula | C14H17N5O6 |
|---|---|
| Molecular weight | 351.31 g/mol |
| IUPAC name | [(2R,3S,5R)-3-acetyloxy-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate |
| InChIKey | QZGYRDUIRRZJHS-IVZWLZJFSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H](C[C@@H](O1)N2C=NC3=C2N=C(NC3=O)N)OC(=O)C |
Computed by PubChem (NCBI)