Products 69992-11-6
CAS 69992-11-6 is the registry number for 2-Amino-6-chloropurine-3’,5’-di-O-acetyl-2’-deoxyriboside. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3S,5S)-3-acetyloxy-5-(2-amino-6-chloropurin-9-yl)oxolan-2-yl]methyl acetate (CAS 69992-11-6) is a chemical compound with the molecular formula C14H16ClN5O5 and a molecular weight of 369.76 g/mol. IUPAC name: [(2R,3S,5S)-3-acetyloxy-5-(2-amino-6-chloropurin-9-yl)oxolan-2-yl]methyl acetate. InChIKey: KMAOKSXABOUEOX-AEJSXWLSSA-N.
| Molecular formula | C14H16ClN5O5 |
|---|---|
| Molecular weight | 369.76 g/mol |
| IUPAC name | [(2R,3S,5S)-3-acetyloxy-5-(2-amino-6-chloropurin-9-yl)oxolan-2-yl]methyl acetate |
| InChIKey | KMAOKSXABOUEOX-AEJSXWLSSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H](C[C@H](O1)N2C=NC3=C2N=C(N=C3Cl)N)OC(=O)C |
Computed by PubChem (NCBI)