CAS 70-30-4 appears in our catalog under these names: Hexachlorophene, >95% (HPLC), Hexachlorophen, Hexachlorophene, Hexachlorophene, >95.0%(GC), Hexachlorophene, 98.00%. Offered by: TRC, Dr. Ehrenstorfer, Mikromol, GLPBio, TCI. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg, 10g, 1x250mg.
3,4,6-trichloro-2-[(2,3,5-trichloro-6-hydroxyphenyl)methyl]phenol (CAS 70-30-4) is a chemical compound with the molecular formula C13H6Cl6O2 and a molecular weight of 406.9 g/mol. IUPAC name: 3,4,6-trichloro-2-[(2,3,5-trichloro-6-hydroxyphenyl)methyl]phenol. InChIKey: ACGUYXCXAPNIKK-UHFFFAOYSA-N.
| Molecular formula | C13H6Cl6O2 |
|---|---|
| Molecular weight | 406.9 g/mol |
| IUPAC name | 3,4,6-trichloro-2-[(2,3,5-trichloro-6-hydroxyphenyl)methyl]phenol |
| InChIKey | ACGUYXCXAPNIKK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)CC2=C(C(=CC(=C2Cl)Cl)Cl)O)O)Cl |
Computed by PubChem (NCBI)