CAS 70-43-9 is the registry number for Barthrin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(6-chloro-1,3-benzodioxol-5-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate (CAS 70-43-9) is a chemical compound with the molecular formula C18H21ClO4 and a molecular weight of 336.8 g/mol. IUPAC name: (6-chloro-1,3-benzodioxol-5-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate. InChIKey: KPMWGGRSOPMANK-UHFFFAOYSA-N.
| Molecular formula | C18H21ClO4 |
|---|---|
| Molecular weight | 336.8 g/mol |
| IUPAC name | (6-chloro-1,3-benzodioxol-5-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| InChIKey | KPMWGGRSOPMANK-UHFFFAOYSA-N |
| SMILES | CC(=CC1C(C1(C)C)C(=O)OCC2=CC3=C(C=C2Cl)OCO3)C |
Computed by PubChem (NCBI)