CAS 70018-13-2 is the registry number for tert-Butyl 2-(methylsulfonyl)acetate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g, 5g.
Tert-butyl 2-methylsulfonylacetate (CAS 70018-13-2) is a chemical compound with the molecular formula C7H14O4S and a molecular weight of 194.25 g/mol. IUPAC name: tert-butyl 2-methylsulfonylacetate. InChIKey: YJEWKWKAXZRQJE-UHFFFAOYSA-N.
| Molecular formula | C7H14O4S |
|---|---|
| Molecular weight | 194.25 g/mol |
| IUPAC name | tert-butyl 2-methylsulfonylacetate |
| InChIKey | YJEWKWKAXZRQJE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CS(=O)(=O)C |
Computed by PubChem (NCBI)