CAS 70020-71-2 appears in our catalog under these names: Zinc acexamate, Zinc acexamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Zinc bis(6-acetamidohexanoate) (CAS 70020-71-2) is a chemical compound with the molecular formula C16H28N2O6Zn and a molecular weight of 409.8 g/mol. IUPAC name: zinc bis(6-acetamidohexanoate). InChIKey: GEVJDDLLVRRIOL-UHFFFAOYSA-L.
| Molecular formula | C16H28N2O6Zn |
|---|---|
| Molecular weight | 409.8 g/mol |
| IUPAC name | zinc bis(6-acetamidohexanoate) |
| InChIKey | GEVJDDLLVRRIOL-UHFFFAOYSA-L |
| SMILES | CC(=O)NCCCCCC(=O)[O-].CC(=O)NCCCCCC(=O)[O-].[Zn+2] |
Computed by PubChem (NCBI)